C20H20FN5O3 — CID 55510874
3-(3-fluoro-4-methylphenyl)-5-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 55510874) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-5-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-5-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55510874 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-5-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-c2noc(CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)n2)cc1F |
| InChI | InChI=1S/C20H20FN5O3/c1-14-2-3-15(12-18(14)21)20-22-19(29-23-20)13-24-8-10-25(11-9-24)16-4-6-17(7-5-16)26(27)28/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | QNFOZMMZVCTZCB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 88.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|