C19H18N2O4S2 — CID 135687417
4-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]phenol (PubChem CID 135687417) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 4-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 135687417 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]phenol |
| SMILES | O=S(=O)(c1ccc(-c2csc(-c3ccc(O)cc3)n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C19H18N2O4S2/c22-16-5-1-15(2-6-16)19-20-18(13-26-19)14-3-7-17(8-4-14)27(23,24)21-9-11-25-12-10-21/h1-8,13,22H,9-12H2 |
| InChIKey | AGFHYKNEBFWXIZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |