C19H20N2O2S3 — CID 171703804
4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-thiophen-3-yl-1,3-thiazole (PubChem CID 171703804) has the molecular formula C19H20N2O2S3 and a molecular weight of 404.58 g/mol. Its IUPAC name is 4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-thiophen-3-yl-1,3-thiazole.
| Compound Name | 4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-thiophen-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 171703804 |
| Molecular Formula | C19H20N2O2S3 |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-thiophen-3-yl-1,3-thiazole |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(-c3csc(-c4ccsc4)n3)cc2)CC1 |
| InChI | InChI=1S/C19H20N2O2S3/c1-14-6-9-21(10-7-14)26(22,23)17-4-2-15(3-5-17)18-13-25-19(20-18)16-8-11-24-12-16/h2-5,8,11-14H,6-7,9-10H2,1H3 |
| InChIKey | HYJZPOORFRBRQW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |