C16H20N2O2S2 — CID 5121126
2-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazole (PubChem CID 5121126) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 5121126 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)cs1 |
| InChI | InChI=1S/C16H20N2O2S2/c1-12-7-9-18(10-8-12)22(19,20)15-5-3-14(4-6-15)16-11-21-13(2)17-16/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | WWDAFOFDBASRGK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |