C22H24N2O3S2 — CID 18293013
4-[4-(azepan-1-ylsulfonyl)phenyl]-2-(3-methoxyphenyl)-1,3-thiazole (PubChem CID 18293013) has the molecular formula C22H24N2O3S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-[4-(azepan-1-ylsulfonyl)phenyl]-2-(3-methoxyphenyl)-1,3-thiazole.
| Compound Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-2-(3-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 18293013 |
| Molecular Formula | C22H24N2O3S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-2-(3-methoxyphenyl)-1,3-thiazole |
| SMILES | COc1cccc(-c2nc(-c3ccc(S(=O)(=O)N4CCCCCC4)cc3)cs2)c1 |
| InChI | InChI=1S/C22H24N2O3S2/c1-27-19-8-6-7-18(15-19)22-23-21(16-28-22)17-9-11-20(12-10-17)29(25,26)24-13-4-2-3-5-14-24/h6-12,15-16H,2-5,13-14H2,1H3 |
| InChIKey | OHYGWMBWQVXVJU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |