C27H25N3O4S2 — CID 19114743
N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide (PubChem CID 19114743) has the molecular formula C27H25N3O4S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 19114743 |
| Molecular Formula | C27H25N3O4S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1nc(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)cs1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25N3O4S2/c31-26(25(21-7-3-1-4-8-21)22-9-5-2-6-10-22)29-27-28-24(19-35-27)20-11-13-23(14-12-20)36(32,33)30-15-17-34-18-16-30/h1-14,19,25H,15-18H2,(H,28,29,31) |
| InChIKey | JXNNFOVLNXAGRP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |