C15H19N3O4S2 — CID 123786548
1-[[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]amino]ethanol (PubChem CID 123786548) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]amino]ethanol.
| Compound Name | 1-[[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 123786548 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-[[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]amino]ethanol |
| SMILES | CC(O)Nc1nc(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)cs1 |
| InChI | InChI=1S/C15H19N3O4S2/c1-11(19)16-15-17-14(10-23-15)12-2-4-13(5-3-12)24(20,21)18-6-8-22-9-7-18/h2-5,10-11,19H,6-9H2,1H3,(H,16,17) |
| InChIKey | BRKMYWPDTHKVSP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|