C20H12N4O2 — CID 168519884
2-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)isoindole-1,3-dione (PubChem CID 168519884) has the molecular formula C20H12N4O2 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)isoindole-1,3-dione.
| Compound Name | 2-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168519884 |
| Molecular Formula | C20H12N4O2 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(-c2cn3cccnc3n2)c1 |
| InChI | InChI=1S/C20H12N4O2/c25-18-15-7-1-2-8-16(15)19(26)24(18)14-6-3-5-13(11-14)17-12-23-10-4-9-21-20(23)22-17/h1-12H |
| InChIKey | AVVGIKGKQZAGOL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|