About 2-pyridin-3-ylimidazo[1,2-a]pyrimidine
2-pyridin-3-ylimidazo[1,2-a]pyrimidine (PubChem CID 10035574) has the molecular formula C11H8N4
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-pyridin-3-ylimidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 2-pyridin-3-ylimidazo[1,2-a]pyrimidine |
| PubChem CID | 10035574 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-pyridin-3-ylimidazo[1,2-a]pyrimidine |
| SMILES | c1cncc(-c2cn3cccnc3n2)c1 |
| InChI | InChI=1S/C11H8N4/c1-3-9(7-12-4-1)10-8-15-6-2-5-13-11(15)14-10/h1-8H |
| InChIKey | YJWSACDYMJKFLY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyridin-3-ylimidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-ylimidazo[1,2-a]pyrimidine?
The IUPAC name of 2-pyridin-3-ylimidazo[1,2-a]pyrimidine (CID 10035574) is 2-pyridin-3-ylimidazo[1,2-a]pyrimidine.
What is the SMILES notation for 2-pyridin-3-ylimidazo[1,2-a]pyrimidine?
The canonical SMILES for 2-pyridin-3-ylimidazo[1,2-a]pyrimidine is c1cncc(-c2cn3cccnc3n2)c1.
What is the InChIKey of 2-pyridin-3-ylimidazo[1,2-a]pyrimidine?
The InChIKey is YJWSACDYMJKFLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4/c1-3-9(7-12-4-1)10-8-15-6-2-5-13-11(15)14-10/h1-8H.
What are the key properties of 2-pyridin-3-ylimidazo[1,2-a]pyrimidine?
2-pyridin-3-ylimidazo[1,2-a]pyrimidine has a molecular weight of 196.21 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-ylimidazo[1,2-a]pyrimidine is sourced from PubChem (CID 10035574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).