C22H13N3O2S — CID 168518992
2-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]isoindole-1,3-dione (PubChem CID 168518992) has the molecular formula C22H13N3O2S and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518992 |
| Molecular Formula | C22H13N3O2S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(-c2csc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C22H13N3O2S/c26-21-17-8-1-2-9-18(17)22(27)25(21)16-7-3-5-14(11-16)19-13-28-20(24-19)15-6-4-10-23-12-15/h1-13H |
| InChIKey | GUYJKKBZIFVXLD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|