C15H13N3S — CID 63152435
[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]methanamine (PubChem CID 63152435) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is [3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]methanamine.
| Compound Name | [3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 63152435 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | [3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]methanamine |
| SMILES | NCc1cccc(-c2csc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C15H13N3S/c16-8-11-3-1-4-12(7-11)14-10-19-15(18-14)13-5-2-6-17-9-13/h1-7,9-10H,8,16H2 |
| InChIKey | DNCUFTKVUSGWIJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |