C17H16N4S2 — CID 108784263
1-ethyl-3-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]thiourea (PubChem CID 108784263) has the molecular formula C17H16N4S2 and a molecular weight of 340.48 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]thiourea.
| Compound Name | 1-ethyl-3-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 108784263 |
| Molecular Formula | C17H16N4S2 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-ethyl-3-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]thiourea |
| SMILES | CCNC(=S)Nc1cccc(-c2csc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C17H16N4S2/c1-2-19-17(22)20-14-7-3-5-12(9-14)15-11-23-16(21-15)13-6-4-8-18-10-13/h3-11H,2H2,1H3,(H2,19,20,22) |
| InChIKey | OCASNYCAJJFQMJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|