C29H21N3OS — CID 108770511
(Z)-2,3-diphenyl-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]prop-2-enamide (PubChem CID 108770511) has the molecular formula C29H21N3OS and a molecular weight of 459.57 g/mol. Its IUPAC name is (Z)-2,3-diphenyl-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2,3-diphenyl-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108770511 |
| Molecular Formula | C29H21N3OS |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (Z)-2,3-diphenyl-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
| SMILES | O=C(Nc1cccc(-c2csc(-c3cccnc3)n2)c1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H21N3OS/c33-28(26(22-11-5-2-6-12-22)17-21-9-3-1-4-10-21)31-25-15-7-13-23(18-25)27-20-34-29(32-27)24-14-8-16-30-19-24/h1-20H,(H,31,33)/b26-17- |
| InChIKey | OAXKZMCUHCEMAW-ONUIUJJFSA-N |
| XLogP | 7.05 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|