C28H20N2OS — CID 108756812
(Z)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2,3-diphenylprop-2-enamide (PubChem CID 108756812) has the molecular formula C28H20N2OS and a molecular weight of 432.55 g/mol. Its IUPAC name is (Z)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 108756812 |
| Molecular Formula | C28H20N2OS |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (Z)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1nc(-c2ccc3ccccc3c2)cs1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H20N2OS/c31-27(25(22-12-5-2-6-13-22)17-20-9-3-1-4-10-20)30-28-29-26(19-32-28)24-16-15-21-11-7-8-14-23(21)18-24/h1-19H,(H,29,30,31)/b25-17- |
| InChIKey | QOESGQZGCUNEFZ-UQQQWYQISA-N |
| XLogP | 7.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|