C24H17ClN2OS — CID 19195372
(E)-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,3-diphenylprop-2-enamide (PubChem CID 19195372) has the molecular formula C24H17ClN2OS and a molecular weight of 416.93 g/mol. Its IUPAC name is (E)-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 19195372 |
| Molecular Formula | C24H17ClN2OS |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (E)-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1nc(-c2ccccc2Cl)cs1)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H17ClN2OS/c25-21-14-8-7-13-19(21)22-16-29-24(26-22)27-23(28)20(18-11-5-2-6-12-18)15-17-9-3-1-4-10-17/h1-16H,(H,26,27,28)/b20-15+ |
| InChIKey | BIRVXISZXFXSOT-HMMYKYKNSA-N |
| XLogP | 6.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|