C14H9ClN2O2S — CID 18102049
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]furan-3-carboxamide (PubChem CID 18102049) has the molecular formula C14H9ClN2O2S and a molecular weight of 304.76 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]furan-3-carboxamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 18102049 |
| Molecular Formula | C14H9ClN2O2S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]furan-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2Cl)cs1)c1ccoc1 |
| InChI | InChI=1S/C14H9ClN2O2S/c15-11-4-2-1-3-10(11)12-8-20-14(16-12)17-13(18)9-5-6-19-7-9/h1-8H,(H,16,17,18) |
| InChIKey | VQORYUWYCJOIMN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |