C16H12N2O2S — CID 80555016
methyl 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzoate (PubChem CID 80555016) has the molecular formula C16H12N2O2S and a molecular weight of 296.35 g/mol. Its IUPAC name is methyl 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzoate.
| Compound Name | methyl 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 80555016 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | methyl 3-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzoate |
| SMILES | COC(=O)c1cccc(-c2nc(-c3cccnc3)cs2)c1 |
| InChI | InChI=1S/C16H12N2O2S/c1-20-16(19)12-5-2-4-11(8-12)15-18-14(10-21-15)13-6-3-7-17-9-13/h2-10H,1H3 |
| InChIKey | FJZBAPUCPNCBEZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |