C15H13N3S — CID 116965446
N-methyl-4-(4-pyridin-3-yl-1,3-thiazol-2-yl)aniline (PubChem CID 116965446) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is N-methyl-4-(4-pyridin-3-yl-1,3-thiazol-2-yl)aniline.
| Compound Name | N-methyl-4-(4-pyridin-3-yl-1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 116965446 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-methyl-4-(4-pyridin-3-yl-1,3-thiazol-2-yl)aniline |
| SMILES | CNc1ccc(-c2nc(-c3cccnc3)cs2)cc1 |
| InChI | InChI=1S/C15H13N3S/c1-16-13-6-4-11(5-7-13)15-18-14(10-19-15)12-3-2-8-17-9-12/h2-10,16H,1H3 |
| InChIKey | FEZTUXCFAWHATB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |