C14H8F2N2S — CID 2800024
4-(3,4-difluorophenyl)-2-pyridin-3-yl-1,3-thiazole (PubChem CID 2800024) has the molecular formula C14H8F2N2S and a molecular weight of 274.30 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 4-(3,4-difluorophenyl)-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 2800024 |
| Molecular Formula | C14H8F2N2S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-pyridin-3-yl-1,3-thiazole |
| SMILES | Fc1ccc(-c2csc(-c3cccnc3)n2)cc1F |
| InChI | InChI=1S/C14H8F2N2S/c15-11-4-3-9(6-12(11)16)13-8-19-14(18-13)10-2-1-5-17-7-10/h1-8H |
| InChIKey | ZRUNXNQWSCECCR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |