C15H10F2N2S — CID 43667884
3-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]aniline (PubChem CID 43667884) has the molecular formula C15H10F2N2S and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]aniline.
| Compound Name | 3-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]aniline |
|---|---|
| PubChem CID | 43667884 |
| Molecular Formula | C15H10F2N2S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]aniline |
| SMILES | Nc1cccc(-c2nc(-c3ccc(F)c(F)c3)cs2)c1 |
| InChI | InChI=1S/C15H10F2N2S/c16-12-5-4-9(7-13(12)17)14-8-20-15(19-14)10-2-1-3-11(18)6-10/h1-8H,18H2 |
| InChIKey | NXTDGXGTZMVARD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|