C16H14N2OS — CID 7148555
3-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]aniline (PubChem CID 7148555) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]aniline.
| Compound Name | 3-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]aniline |
|---|---|
| PubChem CID | 7148555 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]aniline |
| SMILES | COc1cccc(-c2csc(-c3cccc(N)c3)n2)c1 |
| InChI | InChI=1S/C16H14N2OS/c1-19-14-7-3-4-11(9-14)15-10-20-16(18-15)12-5-2-6-13(17)8-12/h2-10H,17H2,1H3 |
| InChIKey | RWYMGPVYWMKGTQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|