C21H13N5OS — CID 168609712
2-[3-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609712) has the molecular formula C21H13N5OS and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-[3-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609712 |
| Molecular Formula | C21H13N5OS |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-[3-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | COc1cccc(-c2csc(-c3cccc(NC(C#N)=C(C#N)C#N)c3)n2)c1 |
| InChI | InChI=1S/C21H13N5OS/c1-27-18-7-3-4-14(9-18)20-13-28-21(26-20)15-5-2-6-17(8-15)25-19(12-24)16(10-22)11-23/h2-9,13,25H,1H3 |
| InChIKey | PJXKTWCPHYDOLF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|