C24H19N3O3S — CID 171982252
N-[3-(4-benzamido-1,3-thiazol-2-yl)phenyl]-3-methoxybenzamide (PubChem CID 171982252) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[3-(4-benzamido-1,3-thiazol-2-yl)phenyl]-3-methoxybenzamide.
| Compound Name | N-[3-(4-benzamido-1,3-thiazol-2-yl)phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 171982252 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[3-(4-benzamido-1,3-thiazol-2-yl)phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(-c3nc(NC(=O)c4ccccc4)cs3)c2)c1 |
| InChI | InChI=1S/C24H19N3O3S/c1-30-20-12-6-9-17(14-20)23(29)25-19-11-5-10-18(13-19)24-27-21(15-31-24)26-22(28)16-7-3-2-4-8-16/h2-15H,1H3,(H,25,29)(H,26,28) |
| InChIKey | IDFBJAGTQZHANG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |