C14H13N3OS — CID 24587652
(Z)-3-amino-2-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]but-2-enenitrile (PubChem CID 24587652) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is (Z)-3-amino-2-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]but-2-enenitrile.
| Compound Name | (Z)-3-amino-2-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 24587652 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (Z)-3-amino-2-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]but-2-enenitrile |
| SMILES | COc1cccc(-c2nc(/C(C#N)=C(\C)N)cs2)c1 |
| InChI | InChI=1S/C14H13N3OS/c1-9(16)12(7-15)13-8-19-14(17-13)10-4-3-5-11(6-10)18-2/h3-6,8H,16H2,1-2H3/b12-9+ |
| InChIKey | WMTGYXSYQHYFRP-FMIVXFBMSA-N |
| XLogP | 3.03 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|