C15H18N2O2S — CID 42866037
N,N-diethyl-2-(3-methoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 42866037) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is N,N-diethyl-2-(3-methoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N,N-diethyl-2-(3-methoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42866037 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N,N-diethyl-2-(3-methoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1csc(-c2cccc(OC)c2)n1 |
| InChI | InChI=1S/C15H18N2O2S/c1-4-17(5-2)15(18)13-10-20-14(16-13)11-7-6-8-12(9-11)19-3/h6-10H,4-5H2,1-3H3 |
| InChIKey | XHLPWESAVICTKL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |