C12H13NO4S2 — CID 174970309
[2-(3-methoxyphenyl)-1,3-thiazol-4-yl] ethanesulfonate (PubChem CID 174970309) has the molecular formula C12H13NO4S2 and a molecular weight of 299.37 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-1,3-thiazol-4-yl] ethanesulfonate.
| Compound Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl] ethanesulfonate |
|---|---|
| PubChem CID | 174970309 |
| Molecular Formula | C12H13NO4S2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1csc(-c2cccc(OC)c2)n1 |
| InChI | InChI=1S/C12H13NO4S2/c1-3-19(14,15)17-11-8-18-12(13-11)9-5-4-6-10(7-9)16-2/h4-8H,3H2,1-2H3 |
| InChIKey | KTPIKKQWOVXLKJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|