C16H17N3S — CID 24587653
(Z)-3-amino-2-[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]but-2-enenitrile (PubChem CID 24587653) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is (Z)-3-amino-2-[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]but-2-enenitrile.
| Compound Name | (Z)-3-amino-2-[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 24587653 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (Z)-3-amino-2-[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]but-2-enenitrile |
| SMILES | C/C(N)=C(/C#N)c1csc(-c2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C16H17N3S/c1-10(2)12-4-6-13(7-5-12)16-19-15(9-20-16)14(8-17)11(3)18/h4-7,9-10H,18H2,1-3H3/b14-11+ |
| InChIKey | GIYYBQMWGSOYQR-SDNWHVSQSA-N |
| XLogP | 4.15 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|