C9H8N4S — CID 23734731
3-amino-2-[2-(cyanomethyl)-1,3-thiazol-4-yl]but-2-enenitrile (PubChem CID 23734731) has the molecular formula C9H8N4S and a molecular weight of 204.26 g/mol. Its IUPAC name is 3-amino-2-[2-(cyanomethyl)-1,3-thiazol-4-yl]but-2-enenitrile.
| Compound Name | 3-amino-2-[2-(cyanomethyl)-1,3-thiazol-4-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 23734731 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-amino-2-[2-(cyanomethyl)-1,3-thiazol-4-yl]but-2-enenitrile |
| SMILES | CC(N)=C(C#N)c1csc(CC#N)n1 |
| InChI | InChI=1S/C9H8N4S/c1-6(12)7(4-11)8-5-14-9(13-8)2-3-10/h5H,2,12H2,1H3 |
| InChIKey | ZOIJTMWRLARNCS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|