C15H16N2S — CID 95464853
2-[4-(4-butylphenyl)-1,3-thiazol-2-yl]acetonitrile (PubChem CID 95464853) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[4-(4-butylphenyl)-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-[4-(4-butylphenyl)-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 95464853 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[4-(4-butylphenyl)-1,3-thiazol-2-yl]acetonitrile |
| SMILES | CCCCc1ccc(-c2csc(CC#N)n2)cc1 |
| InChI | InChI=1S/C15H16N2S/c1-2-3-4-12-5-7-13(8-6-12)14-11-18-15(17-14)9-10-16/h5-8,11H,2-4,9H2,1H3 |
| InChIKey | UTOZYWGHGZOCHD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |