C22H19IN2S — CID 92972046
(Z)-2-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-3-(2-iodophenyl)prop-2-enenitrile (PubChem CID 92972046) has the molecular formula C22H19IN2S and a molecular weight of 470.38 g/mol. Its IUPAC name is (Z)-2-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-3-(2-iodophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-3-(2-iodophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 92972046 |
| Molecular Formula | C22H19IN2S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | (Z)-2-[4-(4-butylphenyl)-1,3-thiazol-2-yl]-3-(2-iodophenyl)prop-2-enenitrile |
| SMILES | CCCCc1ccc(-c2csc(/C(C#N)=C\c3ccccc3I)n2)cc1 |
| InChI | InChI=1S/C22H19IN2S/c1-2-3-6-16-9-11-17(12-10-16)21-15-26-22(25-21)19(14-24)13-18-7-4-5-8-20(18)23/h4-5,7-13,15H,2-3,6H2,1H3/b19-13- |
| InChIKey | UYPHBTDDSQJUCE-UYRXBGFRSA-N |
| XLogP | 6.82 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|