C9H10N2S — CID 116966310
2-(4-cyclobutyl-1,3-thiazol-2-yl)acetonitrile (PubChem CID 116966310) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 2-(4-cyclobutyl-1,3-thiazol-2-yl)acetonitrile.
| Compound Name | 2-(4-cyclobutyl-1,3-thiazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 116966310 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-(4-cyclobutyl-1,3-thiazol-2-yl)acetonitrile |
| SMILES | N#CCc1nc(C2CCC2)cs1 |
| InChI | InChI=1S/C9H10N2S/c10-5-4-9-11-8(6-12-9)7-2-1-3-7/h6-7H,1-4H2 |
| InChIKey | AVMYLJLKNPJYFB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |