C11H15NS — CID 130688661
2,4-di(cyclobutyl)-1,3-thiazole (PubChem CID 130688661) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 2,4-di(cyclobutyl)-1,3-thiazole.
| Compound Name | 2,4-di(cyclobutyl)-1,3-thiazole |
|---|---|
| PubChem CID | 130688661 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2,4-di(cyclobutyl)-1,3-thiazole |
| SMILES | c1sc(C2CCC2)nc1C1CCC1 |
| InChI | InChI=1S/C11H15NS/c1-3-8(4-1)10-7-13-11(12-10)9-5-2-6-9/h7-9H,1-6H2 |
| InChIKey | UYTYORGVWONERD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |