C11H16N2S2 — CID 115043922
2-(azetidin-3-yl)-4-(thian-3-yl)-1,3-thiazole (PubChem CID 115043922) has the molecular formula C11H16N2S2 and a molecular weight of 240.40 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-4-(thian-3-yl)-1,3-thiazole.
| Compound Name | 2-(azetidin-3-yl)-4-(thian-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 115043922 |
| Molecular Formula | C11H16N2S2 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(azetidin-3-yl)-4-(thian-3-yl)-1,3-thiazole |
| SMILES | c1sc(C2CNC2)nc1C1CCCSC1 |
| InChI | InChI=1S/C11H16N2S2/c1-2-8(6-14-3-1)10-7-15-11(13-10)9-4-12-5-9/h7-9,12H,1-6H2 |
| InChIKey | CVWDOGNKPZUCRH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |