C10H13NOS2 — CID 115088245
2-[2-(thian-3-yl)-1,3-thiazol-4-yl]acetaldehyde (PubChem CID 115088245) has the molecular formula C10H13NOS2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[2-(thian-3-yl)-1,3-thiazol-4-yl]acetaldehyde.
| Compound Name | 2-[2-(thian-3-yl)-1,3-thiazol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 115088245 |
| Molecular Formula | C10H13NOS2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-[2-(thian-3-yl)-1,3-thiazol-4-yl]acetaldehyde |
| SMILES | O=CCc1csc(C2CCCSC2)n1 |
| InChI | InChI=1S/C10H13NOS2/c12-4-3-9-7-14-10(11-9)8-2-1-5-13-6-8/h4,7-8H,1-3,5-6H2 |
| InChIKey | VCNBEDLIMOBYBH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|