C9H11NOS2 — CID 115089786
2-[2-(thiolan-3-yl)-1,3-thiazol-5-yl]acetaldehyde (PubChem CID 115089786) has the molecular formula C9H11NOS2 and a molecular weight of 213.33 g/mol. Its IUPAC name is 2-[2-(thiolan-3-yl)-1,3-thiazol-5-yl]acetaldehyde.
| Compound Name | 2-[2-(thiolan-3-yl)-1,3-thiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115089786 |
| Molecular Formula | C9H11NOS2 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 2-[2-(thiolan-3-yl)-1,3-thiazol-5-yl]acetaldehyde |
| SMILES | O=CCc1cnc(C2CCSC2)s1 |
| InChI | InChI=1S/C9H11NOS2/c11-3-1-8-5-10-9(13-8)7-2-4-12-6-7/h3,5,7H,1-2,4,6H2 |
| InChIKey | AGMKDVVAZJJMQG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|