C9H13NOS2 — CID 115089750
1-[2-(thiolan-3-yl)-1,3-thiazol-5-yl]ethanol (PubChem CID 115089750) has the molecular formula C9H13NOS2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-[2-(thiolan-3-yl)-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-(thiolan-3-yl)-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 115089750 |
| Molecular Formula | C9H13NOS2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 1-[2-(thiolan-3-yl)-1,3-thiazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(C2CCSC2)s1 |
| InChI | InChI=1S/C9H13NOS2/c1-6(11)8-4-10-9(13-8)7-2-3-12-5-7/h4,6-7,11H,2-3,5H2,1H3 |
| InChIKey | RJUVDXYRUFAWSN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |