C10H15NO3S2 — CID 115090326
1-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-5-yl]ethanol (PubChem CID 115090326) has the molecular formula C10H15NO3S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 115090326 |
| Molecular Formula | C10H15NO3S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 1-[2-(1,1-dioxothian-3-yl)-1,3-thiazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(C2CCCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C10H15NO3S2/c1-7(12)9-5-11-10(15-9)8-3-2-4-16(13,14)6-8/h5,7-8,12H,2-4,6H2,1H3 |
| InChIKey | KVEGKRJNXREQNC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |