C11H17NO3S2 — CID 115091052
1-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-thiazol-5-yl]ethanol (PubChem CID 115091052) has the molecular formula C11H17NO3S2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 115091052 |
| Molecular Formula | C11H17NO3S2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-thiazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(CC2CCCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C11H17NO3S2/c1-8(13)10-6-12-11(16-10)5-9-3-2-4-17(14,15)7-9/h6,8-9,13H,2-5,7H2,1H3 |
| InChIKey | PGKFRDUOBFIHCB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |