C11H17NOS2 — CID 115090169
1-[2-(thian-4-ylmethyl)-1,3-thiazol-5-yl]ethanol (PubChem CID 115090169) has the molecular formula C11H17NOS2 and a molecular weight of 243.40 g/mol. Its IUPAC name is 1-[2-(thian-4-ylmethyl)-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-(thian-4-ylmethyl)-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 115090169 |
| Molecular Formula | C11H17NOS2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 1-[2-(thian-4-ylmethyl)-1,3-thiazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(CC2CCSCC2)s1 |
| InChI | InChI=1S/C11H17NOS2/c1-8(13)10-7-12-11(15-10)6-9-2-4-14-5-3-9/h7-9,13H,2-6H2,1H3 |
| InChIKey | FNDVDKOGWNNADG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |