C12H19NOS2 — CID 115090197
1-[2-(thian-4-ylmethyl)-1,3-thiazol-5-yl]propan-2-ol (PubChem CID 115090197) has the molecular formula C12H19NOS2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-[2-(thian-4-ylmethyl)-1,3-thiazol-5-yl]propan-2-ol.
| Compound Name | 1-[2-(thian-4-ylmethyl)-1,3-thiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 115090197 |
| Molecular Formula | C12H19NOS2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-[2-(thian-4-ylmethyl)-1,3-thiazol-5-yl]propan-2-ol |
| SMILES | CC(O)Cc1cnc(CC2CCSCC2)s1 |
| InChI | InChI=1S/C12H19NOS2/c1-9(14)6-11-8-13-12(16-11)7-10-2-4-15-5-3-10/h8-10,14H,2-7H2,1H3 |
| InChIKey | YJDQZUBAZJNLLQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |