C11H15NO2S2 — CID 115090159
3-[2-(thiolan-3-ylmethyl)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 115090159) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-[2-(thiolan-3-ylmethyl)-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[2-(thiolan-3-ylmethyl)-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 115090159 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-[2-(thiolan-3-ylmethyl)-1,3-thiazol-5-yl]propanoic acid |
| SMILES | O=C(O)CCc1cnc(CC2CCSC2)s1 |
| InChI | InChI=1S/C11H15NO2S2/c13-11(14)2-1-9-6-12-10(16-9)5-8-3-4-15-7-8/h6,8H,1-5,7H2,(H,13,14) |
| InChIKey | KRCJFURDAJTNCH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |