C7H8FNO2S — CID 84771017
3-[2-(fluoromethyl)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 84771017) has the molecular formula C7H8FNO2S and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-[2-(fluoromethyl)-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[2-(fluoromethyl)-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 84771017 |
| Molecular Formula | C7H8FNO2S |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | 3-[2-(fluoromethyl)-1,3-thiazol-5-yl]propanoic acid |
| SMILES | O=C(O)CCc1cnc(CF)s1 |
| InChI | InChI=1S/C7H8FNO2S/c8-3-6-9-4-5(12-6)1-2-7(10)11/h4H,1-3H2,(H,10,11) |
| InChIKey | LHEJLBKAKHZHSO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |