C7H11N3O2S — CID 91426781
3-[2-(2-methylhydrazinyl)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 91426781) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-[2-(2-methylhydrazinyl)-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[2-(2-methylhydrazinyl)-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 91426781 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-[2-(2-methylhydrazinyl)-1,3-thiazol-5-yl]propanoic acid |
| SMILES | CNNc1ncc(CCC(=O)O)s1 |
| InChI | InChI=1S/C7H11N3O2S/c1-8-10-7-9-4-5(13-7)2-3-6(11)12/h4,8H,2-3H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | CPGAQWQHDZPHRU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|