4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid

C14H14N2O3S — CID 27407164

IUPAC4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)Nc1ncc(Cc2ccccc2)s1
InChIInChI=1S/C14H14N2O3S/c17-12(6-7-13(18)19)16-14-15-9-11(20-14)8-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,18,19)(H,15,16,17)
InChIKeyCUQBAUUAUGSFNW-UHFFFAOYSA-N
MW290.34 g/mol
LogP2.54
Rot. Bonds6

About 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid

4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid (PubChem CID 27407164) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid.

Molecular Properties

Compound Name4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid
PubChem CID27407164
Molecular FormulaC14H14N2O3S
Molecular Weight290.34 g/mol
Exact Mass290.07
IUPAC Name4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)Nc1ncc(Cc2ccccc2)s1
InChIInChI=1S/C14H14N2O3S/c17-12(6-7-13(18)19)16-14-15-9-11(20-14)8-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,18,19)(H,15,16,17)
InChIKeyCUQBAUUAUGSFNW-UHFFFAOYSA-N
XLogP2.54
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.34
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid?
The IUPAC name of 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid (CID 27407164) is 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid?
The canonical SMILES for 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid is O=C(O)CCC(=O)Nc1ncc(Cc2ccccc2)s1.
What is the InChIKey of 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid?
The InChIKey is CUQBAUUAUGSFNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3S/c17-12(6-7-13(18)19)16-14-15-9-11(20-14)8-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,18,19)(H,15,16,17).
What are the key properties of 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid?
4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid has a molecular weight of 290.34 g/mol, XLogP of 2.54, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-benzyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid is sourced from PubChem (CID 27407164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).