C15H20ClN3OS — CID 120559194
4-amino-N-(5-benzyl-1,3-thiazol-2-yl)pentanamide;hydrochloride (PubChem CID 120559194) has the molecular formula C15H20ClN3OS and a molecular weight of 325.86 g/mol. Its IUPAC name is 4-amino-N-(5-benzyl-1,3-thiazol-2-yl)pentanamide;hydrochloride.
| Compound Name | 4-amino-N-(5-benzyl-1,3-thiazol-2-yl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120559194 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-amino-N-(5-benzyl-1,3-thiazol-2-yl)pentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)Nc1ncc(Cc2ccccc2)s1.Cl |
| InChI | InChI=1S/C15H19N3OS.ClH/c1-11(16)7-8-14(19)18-15-17-10-13(20-15)9-12-5-3-2-4-6-12;/h2-6,10-11H,7-9,16H2,1H3,(H,17,18,19);1H |
| InChIKey | OLWKALYWHQDVDM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |