C23H19FN2O2S — CID 17015011
N-(5-benzyl-1,3-thiazol-2-yl)-3-[5-(4-fluorophenyl)furan-2-yl]propanamide (PubChem CID 17015011) has the molecular formula C23H19FN2O2S and a molecular weight of 406.48 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-3-[5-(4-fluorophenyl)furan-2-yl]propanamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-3-[5-(4-fluorophenyl)furan-2-yl]propanamide |
|---|---|
| PubChem CID | 17015011 |
| Molecular Formula | C23H19FN2O2S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-3-[5-(4-fluorophenyl)furan-2-yl]propanamide |
| SMILES | O=C(CCc1ccc(-c2ccc(F)cc2)o1)Nc1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C23H19FN2O2S/c24-18-8-6-17(7-9-18)21-12-10-19(28-21)11-13-22(27)26-23-25-15-20(29-23)14-16-4-2-1-3-5-16/h1-10,12,15H,11,13-14H2,(H,25,26,27) |
| InChIKey | NESWLGJURQEZIS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |