C16H13FN2O2S — CID 17015017
3-[5-(4-fluorophenyl)furan-2-yl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 17015017) has the molecular formula C16H13FN2O2S and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)furan-2-yl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[5-(4-fluorophenyl)furan-2-yl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 17015017 |
| Molecular Formula | C16H13FN2O2S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-[5-(4-fluorophenyl)furan-2-yl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCc1ccc(-c2ccc(F)cc2)o1)Nc1nccs1 |
| InChI | InChI=1S/C16H13FN2O2S/c17-12-3-1-11(2-4-12)14-7-5-13(21-14)6-8-15(20)19-16-18-9-10-22-16/h1-5,7,9-10H,6,8H2,(H,18,19,20) |
| InChIKey | RWMBPXWXMUBJLE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |