C15H13FN4OS2 — CID 3593088
2-[5-(4-fluorophenyl)-1-methylimidazol-2-yl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 3593088) has the molecular formula C15H13FN4OS2 and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)-1-methylimidazol-2-yl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[5-(4-fluorophenyl)-1-methylimidazol-2-yl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3593088 |
| Molecular Formula | C15H13FN4OS2 |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-[5-(4-fluorophenyl)-1-methylimidazol-2-yl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | Cn1c(-c2ccc(F)cc2)cnc1SCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C15H13FN4OS2/c1-20-12(10-2-4-11(16)5-3-10)8-18-15(20)23-9-13(21)19-14-17-6-7-22-14/h2-8H,9H2,1H3,(H,17,19,21) |
| InChIKey | QIPLWJNEMJBQNU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|