C17H14N4OS2 — CID 40671159
N-(3-cyanothiophen-2-yl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide (PubChem CID 40671159) has the molecular formula C17H14N4OS2 and a molecular weight of 354.46 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 40671159 |
| Molecular Formula | C17H14N4OS2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide |
| SMILES | Cn1c(-c2ccccc2)cnc1SCC(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C17H14N4OS2/c1-21-14(12-5-3-2-4-6-12)10-19-17(21)24-11-15(22)20-16-13(9-18)7-8-23-16/h2-8,10H,11H2,1H3,(H,20,22) |
| InChIKey | TYLYWTPNGWJLLI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|