C18H15Cl2N3OS — CID 40510747
N-(2,6-dichlorophenyl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide (PubChem CID 40510747) has the molecular formula C18H15Cl2N3OS and a molecular weight of 392.31 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 40510747 |
| Molecular Formula | C18H15Cl2N3OS |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-(1-methyl-5-phenylimidazol-2-yl)sulfanylacetamide |
| SMILES | Cn1c(-c2ccccc2)cnc1SCC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H15Cl2N3OS/c1-23-15(12-6-3-2-4-7-12)10-21-18(23)25-11-16(24)22-17-13(19)8-5-9-14(17)20/h2-10H,11H2,1H3,(H,22,24) |
| InChIKey | QEDDEKQWTTWBBC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|